C16H19NOS — CID 4657849
2-(2,5-dimethylthiophen-3-yl)-5-ethoxy-2,3-dihydro-1H-indole (PubChem CID 4657849) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-(2,5-dimethylthiophen-3-yl)-5-ethoxy-2,3-dihydro-1H-indole.
| Compound Name | 2-(2,5-dimethylthiophen-3-yl)-5-ethoxy-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 4657849 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-(2,5-dimethylthiophen-3-yl)-5-ethoxy-2,3-dihydro-1H-indole |
| SMILES | CCOc1ccc2c(c1)CC(c1cc(C)sc1C)N2 |
| InChI | InChI=1S/C16H19NOS/c1-4-18-13-5-6-15-12(8-13)9-16(17-15)14-7-10(2)19-11(14)3/h5-8,16-17H,4,9H2,1-3H3 |
| InChIKey | MSKKQNIFGNTVNW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|