C11H14ClNO — CID 164664996
1-chloro-6-ethoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 164664996) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 1-chloro-6-ethoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-chloro-6-ethoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 164664996 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-chloro-6-ethoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCOc1ccc2c(c1)CCNC2Cl |
| InChI | InChI=1S/C11H14ClNO/c1-2-14-9-3-4-10-8(7-9)5-6-13-11(10)12/h3-4,7,11,13H,2,5-6H2,1H3 |
| InChIKey | PKYPUOAEPNITQK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|