C14H19NO2 — CID 102338901
3-ethenyl-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 102338901) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 3-ethenyl-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-ethenyl-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 102338901 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-ethenyl-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | C=CC1Cc2cc(OC)c(OC)cc2NC1C |
| InChI | InChI=1S/C14H19NO2/c1-5-10-6-11-7-13(16-3)14(17-4)8-12(11)15-9(10)2/h5,7-10,15H,1,6H2,2-4H3 |
| InChIKey | SISIUUOKBDBITP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|