C12H16ClNO4 — CID 44665977
(3R)-6,7-dimethoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid;hydrochloride (PubChem CID 44665977) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is (3R)-6,7-dimethoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid;hydrochloride.
| Compound Name | (3R)-6,7-dimethoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 44665977 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | (3R)-6,7-dimethoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid;hydrochloride |
| SMILES | COc1cc2c(cc1OC)NC[C@H](C(=O)O)C2.Cl |
| InChI | InChI=1S/C12H15NO4.ClH/c1-16-10-4-7-3-8(12(14)15)6-13-9(7)5-11(10)17-2;/h4-5,8,13H,3,6H2,1-2H3,(H,14,15);1H/t8-;/m1./s1 |
| InChIKey | BFFXYDOVMZCTSH-DDWIOCJRSA-N |
| XLogP | 1.79 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|