About (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid
(3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid (PubChem CID 96616866) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid.
Analyze (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid?
The IUPAC name of (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid (CID 96616866) is (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid.
What is the SMILES notation for (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid?
The canonical SMILES for (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid is COc1cccc2c1NC[C@H](C(=O)O)C2.
What is the InChIKey of (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid?
The InChIKey is OUXJNEDFSALDFX-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-15-9-4-2-3-7-5-8(11(13)14)6-12-10(7)9/h2-4,8,12H,5-6H2,1H3,(H,13,14)/t8-/m1/s1.
What are the key properties of (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid?
(3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid has a molecular weight of 207.23 g/mol, XLogP of 1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid is sourced from PubChem (CID 96616866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).