(3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid

C11H13NO3 — CID 96616866

IUPAC(3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid
SMILESCOc1cccc2c1NC[C@H](C(=O)O)C2
InChIInChI=1S/C11H13NO3/c1-15-9-4-2-3-7-5-8(11(13)14)6-12-10(7)9/h2-4,8,12H,5-6H2,1H3,(H,13,14)/t8-/m1/s1
InChIKeyOUXJNEDFSALDFX-MRVPVSSYSA-N
MW207.23 g/mol
LogP1.36
Rot. Bonds2

About (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid

(3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid (PubChem CID 96616866) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid.

Molecular Properties

Compound Name(3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid
PubChem CID96616866
Molecular FormulaC11H13NO3
Molecular Weight207.23 g/mol
Exact Mass207.09
IUPAC Name(3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid
SMILESCOc1cccc2c1NC[C@H](C(=O)O)C2
InChIInChI=1S/C11H13NO3/c1-15-9-4-2-3-7-5-8(11(13)14)6-12-10(7)9/h2-4,8,12H,5-6H2,1H3,(H,13,14)/t8-/m1/s1
InChIKeyOUXJNEDFSALDFX-MRVPVSSYSA-N
XLogP1.36
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.23
LogP ≤ 51.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid?
The IUPAC name of (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid (CID 96616866) is (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid.
What is the SMILES notation for (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid?
The canonical SMILES for (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid is COc1cccc2c1NC[C@H](C(=O)O)C2.
What is the InChIKey of (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid?
The InChIKey is OUXJNEDFSALDFX-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-15-9-4-2-3-7-5-8(11(13)14)6-12-10(7)9/h2-4,8,12H,5-6H2,1H3,(H,13,14)/t8-/m1/s1.
What are the key properties of (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid?
(3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid has a molecular weight of 207.23 g/mol, XLogP of 1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-8-methoxy-1,2,3,4-tetrahydroquinoline-3-carboxylic acid is sourced from PubChem (CID 96616866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).