C10H11NO3 — CID 82277350
4-methoxy-2,3-dihydro-1H-indole-3-carboxylic acid (PubChem CID 82277350) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 4-methoxy-2,3-dihydro-1H-indole-3-carboxylic acid.
| Compound Name | 4-methoxy-2,3-dihydro-1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 82277350 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-methoxy-2,3-dihydro-1H-indole-3-carboxylic acid |
| SMILES | COc1cccc2c1C(C(=O)O)CN2 |
| InChI | InChI=1S/C10H11NO3/c1-14-8-4-2-3-7-9(8)6(5-11-7)10(12)13/h2-4,6,11H,5H2,1H3,(H,12,13) |
| InChIKey | KMXLHXMNMWVYAB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |