About 4-methoxy-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid
4-methoxy-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid (PubChem CID 112716859) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-methoxy-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid.
Analyze 4-methoxy-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid?
The IUPAC name of 4-methoxy-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid (CID 112716859) is 4-methoxy-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid.
What is the SMILES notation for 4-methoxy-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid?
The canonical SMILES for 4-methoxy-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid is COc1cccc2c1C(C)C(C(=O)O)N2.
What is the InChIKey of 4-methoxy-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid?
The InChIKey is INFFYJQKHKTXQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-6-9-7(12-10(6)11(13)14)4-3-5-8(9)15-2/h3-6,10,12H,1-2H3,(H,13,14).
What are the key properties of 4-methoxy-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid?
4-methoxy-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid has a molecular weight of 207.23 g/mol, XLogP of 1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3-methyl-2,3-dihydro-1H-indole-2-carboxylic acid is sourced from PubChem (CID 112716859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).