9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid

C12H14O3S — CID 82388638

IUPAC9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid
SMILESCOc1cccc2c1SCCC(C(=O)O)C2
InChIInChI=1S/C12H14O3S/c1-15-10-4-2-3-8-7-9(12(13)14)5-6-16-11(8)10/h2-4,9H,5-7H2,1H3,(H,13,14)
InChIKeyQRIBAYANPVXCQJ-UHFFFAOYSA-N
MW238.31 g/mol
LogP2.43
Rot. Bonds2

About 9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid

9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid (PubChem CID 82388638) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is 9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid.

Molecular Properties

Compound Name9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid
PubChem CID82388638
Molecular FormulaC12H14O3S
Molecular Weight238.31 g/mol
Exact Mass238.07
IUPAC Name9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid
SMILESCOc1cccc2c1SCCC(C(=O)O)C2
InChIInChI=1S/C12H14O3S/c1-15-10-4-2-3-8-7-9(12(13)14)5-6-16-11(8)10/h2-4,9H,5-7H2,1H3,(H,13,14)
InChIKeyQRIBAYANPVXCQJ-UHFFFAOYSA-N
XLogP2.43
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.31
LogP ≤ 52.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid?
The IUPAC name of 9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid (CID 82388638) is 9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid.
What is the SMILES notation for 9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid?
The canonical SMILES for 9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid is COc1cccc2c1SCCC(C(=O)O)C2.
What is the InChIKey of 9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid?
The InChIKey is QRIBAYANPVXCQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3S/c1-15-10-4-2-3-8-7-9(12(13)14)5-6-16-11(8)10/h2-4,9H,5-7H2,1H3,(H,13,14).
What are the key properties of 9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid?
9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid has a molecular weight of 238.31 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-2,3,4,5-tetrahydro-1-benzothiepine-4-carboxylic acid is sourced from PubChem (CID 82388638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).