C21H33N3O6 — CID 71698262
tert-butyl N-[(3S)-6,7-dimethoxy-1,2,3,4-tetrahydroquinolin-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 71698262) has the molecular formula C21H33N3O6 and a molecular weight of 423.51 g/mol. Its IUPAC name is tert-butyl N-[(3S)-6,7-dimethoxy-1,2,3,4-tetrahydroquinolin-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-[(3S)-6,7-dimethoxy-1,2,3,4-tetrahydroquinolin-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 71698262 |
| Molecular Formula | C21H33N3O6 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | tert-butyl N-[(3S)-6,7-dimethoxy-1,2,3,4-tetrahydroquinolin-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | COc1cc2c(cc1OC)NC[C@@H](N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C21H33N3O6/c1-20(2,3)29-18(25)23-24(19(26)30-21(4,5)6)14-9-13-10-16(27-7)17(28-8)11-15(13)22-12-14/h10-11,14,22H,9,12H2,1-8H3,(H,23,25)/t14-/m0/s1 |
| InChIKey | RGSMWSGFXNLJAX-AWEZNQCLSA-N |
| XLogP | 3.72 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|