C21H24N2O3 — CID 90698838
tert-butyl N-benzoyl-N-(1,2,3,4-tetrahydroquinolin-3-yl)carbamate (PubChem CID 90698838) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is tert-butyl N-benzoyl-N-(1,2,3,4-tetrahydroquinolin-3-yl)carbamate.
| Compound Name | tert-butyl N-benzoyl-N-(1,2,3,4-tetrahydroquinolin-3-yl)carbamate |
|---|---|
| PubChem CID | 90698838 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | tert-butyl N-benzoyl-N-(1,2,3,4-tetrahydroquinolin-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)c1ccccc1)C1CNc2ccccc2C1 |
| InChI | InChI=1S/C21H24N2O3/c1-21(2,3)26-20(25)23(19(24)15-9-5-4-6-10-15)17-13-16-11-7-8-12-18(16)22-14-17/h4-12,17,22H,13-14H2,1-3H3 |
| InChIKey | NAKRJOIMEMRLCC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |