About tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate
tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate (PubChem CID 70234918) has the molecular formula C19H27N3O3
and a molecular weight of 345.44 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate |
| PubChem CID | 70234918 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)[C@H]1Cc2ccccc2N1)C1CCNCC1 |
| InChI | InChI=1S/C19H27N3O3/c1-19(2,3)25-18(24)22(14-8-10-20-11-9-14)17(23)16-12-13-6-4-5-7-15(13)21-16/h4-7,14,16,20-21H,8-12H2,1-3H3/t16-/m1/s1 |
| InChIKey | SDABRQXGFNNESW-MRXNPFEDSA-N |
| XLogP | 2.54 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate?
The IUPAC name of tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate (CID 70234918) is tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate.
What is the SMILES notation for tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate?
The canonical SMILES for tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate is CC(C)(C)OC(=O)N(C(=O)[C@H]1Cc2ccccc2N1)C1CCNCC1.
What is the InChIKey of tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate?
The InChIKey is SDABRQXGFNNESW-MRXNPFEDSA-N. The full InChI is InChI=1S/C19H27N3O3/c1-19(2,3)25-18(24)22(14-8-10-20-11-9-14)17(23)16-12-13-6-4-5-7-15(13)21-16/h4-7,14,16,20-21H,8-12H2,1-3H3/t16-/m1/s1.
What are the key properties of tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate?
tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate has a molecular weight of 345.44 g/mol, XLogP of 2.54, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]-N-piperidin-4-ylcarbamate is sourced from PubChem (CID 70234918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).