C14H25N3O5 — CID 19788657
tert-butyl N-(2-methyl-4-oxoazetidin-3-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 19788657) has the molecular formula C14H25N3O5 and a molecular weight of 315.37 g/mol. Its IUPAC name is tert-butyl N-(2-methyl-4-oxoazetidin-3-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-(2-methyl-4-oxoazetidin-3-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 19788657 |
| Molecular Formula | C14H25N3O5 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | tert-butyl N-(2-methyl-4-oxoazetidin-3-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CC1NC(=O)C1N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25N3O5/c1-8-9(10(18)15-8)17(12(20)22-14(5,6)7)16-11(19)21-13(2,3)4/h8-9H,1-7H3,(H,15,18)(H,16,19) |
| InChIKey | JXSMIWIFWAZESC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|