C10H17N3O4 — CID 134989075
tert-butyl N-[[(2S,3S)-2-methyl-4-oxoazetidine-3-carbonyl]amino]carbamate (PubChem CID 134989075) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is tert-butyl N-[[(2S,3S)-2-methyl-4-oxoazetidine-3-carbonyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(2S,3S)-2-methyl-4-oxoazetidine-3-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 134989075 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | tert-butyl N-[[(2S,3S)-2-methyl-4-oxoazetidine-3-carbonyl]amino]carbamate |
| SMILES | C[C@@H]1NC(=O)[C@H]1C(=O)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H17N3O4/c1-5-6(7(14)11-5)8(15)12-13-9(16)17-10(2,3)4/h5-6H,1-4H3,(H,11,14)(H,12,15)(H,13,16)/t5-,6-/m0/s1 |
| InChIKey | OOSVZQCWDLFRDA-WDSKDSINSA-N |
| XLogP | -0.32 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|