C10H18N2O3 — CID 174710575
tert-butyl N-[(2S)-3,3-dimethyl-4-oxoazetidin-2-yl]carbamate (PubChem CID 174710575) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3,3-dimethyl-4-oxoazetidin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3,3-dimethyl-4-oxoazetidin-2-yl]carbamate |
|---|---|
| PubChem CID | 174710575 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | tert-butyl N-[(2S)-3,3-dimethyl-4-oxoazetidin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1NC(=O)C1(C)C |
| InChI | InChI=1S/C10H18N2O3/c1-9(2,3)15-8(14)12-6-10(4,5)7(13)11-6/h6H,1-5H3,(H,11,13)(H,12,14)/t6-/m0/s1 |
| InChIKey | BZKWQDMUFYKZFD-LURJTMIESA-N |
| XLogP | 0.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |