C8H14N2O3S — CID 143199969
tert-butyl N-(4-oxo-1,3-thiazolidin-2-yl)carbamate (PubChem CID 143199969) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is tert-butyl N-(4-oxo-1,3-thiazolidin-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-oxo-1,3-thiazolidin-2-yl)carbamate |
|---|---|
| PubChem CID | 143199969 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | tert-butyl N-(4-oxo-1,3-thiazolidin-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1NC(=O)CS1 |
| InChI | InChI=1S/C8H14N2O3S/c1-8(2,3)13-7(12)10-6-9-5(11)4-14-6/h6H,4H2,1-3H3,(H,9,11)(H,10,12) |
| InChIKey | QYLJOUNWUDDNTF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |