C11H24N2O3S — CID 143233012
tert-butyl N-(5-oxo-1,4-thiazocan-6-yl)carbamate;molecular hydrogen (PubChem CID 143233012) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is tert-butyl N-(5-oxo-1,4-thiazocan-6-yl)carbamate;molecular hydrogen.
| Compound Name | tert-butyl N-(5-oxo-1,4-thiazocan-6-yl)carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 143233012 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | tert-butyl N-(5-oxo-1,4-thiazocan-6-yl)carbamate;molecular hydrogen |
| SMILES | CC(C)(C)OC(=O)NC1CCSCCNC1=O.[H][H].[H][H] |
| InChI | InChI=1S/C11H20N2O3S.2H2/c1-11(2,3)16-10(15)13-8-4-6-17-7-5-12-9(8)14;;/h8H,4-7H2,1-3H3,(H,12,14)(H,13,15);2*1H |
| InChIKey | FAYWFIXPKWGOBZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |