C17H34N2O4Si — CID 11728063
tert-butyl N-[(3S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxoazepan-3-yl]carbamate (PubChem CID 11728063) has the molecular formula C17H34N2O4Si and a molecular weight of 358.56 g/mol. Its IUPAC name is tert-butyl N-[(3S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxoazepan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxoazepan-3-yl]carbamate |
|---|---|
| PubChem CID | 11728063 |
| Molecular Formula | C17H34N2O4Si |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | tert-butyl N-[(3S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxoazepan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](O[Si](C)(C)C(C)(C)C)CNC1=O |
| InChI | InChI=1S/C17H34N2O4Si/c1-16(2,3)22-15(21)19-13-10-9-12(11-18-14(13)20)23-24(7,8)17(4,5)6/h12-13H,9-11H2,1-8H3,(H,18,20)(H,19,21)/t12-,13+/m1/s1 |
| InChIKey | YMLPRBLVLVRJDI-OLZOCXBDSA-N |
| XLogP | 3.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|