C12H21N2O3+ — CID 166571691
tert-butyl N-[(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamate (PubChem CID 166571691) has the molecular formula C12H21N2O3+ and a molecular weight of 241.31 g/mol. Its IUPAC name is tert-butyl N-[(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamate |
|---|---|
| PubChem CID | 166571691 |
| Molecular Formula | C12H21N2O3+ |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | tert-butyl N-[(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamate |
| SMILES | [CH2+][C@@H]1CCC[C@@H](NC(=O)OC(C)(C)C)C(=O)N1 |
| InChI | InChI=1S/C12H20N2O3/c1-8-6-5-7-9(10(15)13-8)14-11(16)17-12(2,3)4/h8-9H,1,5-7H2,2-4H3,(H-,13,14,15,16)/p+1/t8-,9-/m1/s1 |
| InChIKey | ZSADBGIJMUXNQE-RKDXNWHRSA-O |
| XLogP | 1.38 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|