C12H22N2O4 — CID 102263285
tert-butyl N-[(3S,6R)-6-hydroxy-2-oxoazocan-3-yl]carbamate (PubChem CID 102263285) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is tert-butyl N-[(3S,6R)-6-hydroxy-2-oxoazocan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,6R)-6-hydroxy-2-oxoazocan-3-yl]carbamate |
|---|---|
| PubChem CID | 102263285 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | tert-butyl N-[(3S,6R)-6-hydroxy-2-oxoazocan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](O)CCNC1=O |
| InChI | InChI=1S/C12H22N2O4/c1-12(2,3)18-11(17)14-9-5-4-8(15)6-7-13-10(9)16/h8-9,15H,4-7H2,1-3H3,(H,13,16)(H,14,17)/t8-,9+/m1/s1 |
| InChIKey | YTNILUHALQNEFL-BDAKNGLRSA-N |
| XLogP | 0.54 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |