C11H17F2NO2 — CID 129026517
tert-butyl N-[(1S)-2-(difluoromethylidene)cyclopentyl]carbamate (PubChem CID 129026517) has the molecular formula C11H17F2NO2 and a molecular weight of 233.26 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-(difluoromethylidene)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-(difluoromethylidene)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 129026517 |
| Molecular Formula | C11H17F2NO2 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | tert-butyl N-[(1S)-2-(difluoromethylidene)cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC1=C(F)F |
| InChI | InChI=1S/C11H17F2NO2/c1-11(2,3)16-10(15)14-8-6-4-5-7(8)9(12)13/h8H,4-6H2,1-3H3,(H,14,15)/t8-/m0/s1 |
| InChIKey | LNRLSPNPZLQQBB-QMMMGPOBSA-N |
| XLogP | 3.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |