C14H23NO2 — CID 118155899
tert-butyl N-[(3Z)-3-ethylidene-2-methylidenecyclohexyl]carbamate (PubChem CID 118155899) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is tert-butyl N-[(3Z)-3-ethylidene-2-methylidenecyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(3Z)-3-ethylidene-2-methylidenecyclohexyl]carbamate |
|---|---|
| PubChem CID | 118155899 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | tert-butyl N-[(3Z)-3-ethylidene-2-methylidenecyclohexyl]carbamate |
| SMILES | C=C1/C(=C\C)CCCC1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO2/c1-6-11-8-7-9-12(10(11)2)15-13(16)17-14(3,4)5/h6,12H,2,7-9H2,1,3-5H3,(H,15,16)/b11-6- |
| InChIKey | KIKPOEQVICAANY-WDZFZDKYSA-N |
| XLogP | 3.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |