C12H19F2NO2 — CID 171829556
tert-butyl N-[(1R)-3-(difluoromethylidene)cyclohexyl]carbamate (PubChem CID 171829556) has the molecular formula C12H19F2NO2 and a molecular weight of 247.28 g/mol. Its IUPAC name is tert-butyl N-[(1R)-3-(difluoromethylidene)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-3-(difluoromethylidene)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 171829556 |
| Molecular Formula | C12H19F2NO2 |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | tert-butyl N-[(1R)-3-(difluoromethylidene)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC(=C(F)F)C1 |
| InChI | InChI=1S/C12H19F2NO2/c1-12(2,3)17-11(16)15-9-6-4-5-8(7-9)10(13)14/h9H,4-7H2,1-3H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | YQISAJOMERLVNA-SECBINFHSA-N |
| XLogP | 3.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |