C15H26N2O3 — CID 71274909
tert-butyl N-[(9aR)-6-methyl-4-oxo-1,2,3,6,7,8,9,9a-octahydroquinolizin-3-yl]carbamate (PubChem CID 71274909) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is tert-butyl N-[(9aR)-6-methyl-4-oxo-1,2,3,6,7,8,9,9a-octahydroquinolizin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(9aR)-6-methyl-4-oxo-1,2,3,6,7,8,9,9a-octahydroquinolizin-3-yl]carbamate |
|---|---|
| PubChem CID | 71274909 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | tert-butyl N-[(9aR)-6-methyl-4-oxo-1,2,3,6,7,8,9,9a-octahydroquinolizin-3-yl]carbamate |
| SMILES | CC1CCC[C@@H]2CCC(NC(=O)OC(C)(C)C)C(=O)N12 |
| InChI | InChI=1S/C15H26N2O3/c1-10-6-5-7-11-8-9-12(13(18)17(10)11)16-14(19)20-15(2,3)4/h10-12H,5-9H2,1-4H3,(H,16,19)/t10?,11-,12?/m1/s1 |
| InChIKey | QSDBTWMDKYAQAE-MOENNCHZSA-N |
| XLogP | 2.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |