C16H30N2O3 — CID 129070915
tert-butyl N-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]carbamate (PubChem CID 129070915) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is tert-butyl N-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]carbamate |
|---|---|
| PubChem CID | 129070915 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | tert-butyl N-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexanecarbonyl]amino]carbamate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1C(=O)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N2O3/c1-10(2)12-8-7-11(3)9-13(12)14(19)17-18-15(20)21-16(4,5)6/h10-13H,7-9H2,1-6H3,(H,17,19)(H,18,20)/t11-,12+,13-/m1/s1 |
| InChIKey | SMIWEPZMHNHBFL-FRRDWIJNSA-N |
| XLogP | 3.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|