C34H38N2O4 — CID 24745411
tert-butyl N-[(1R,5R)-2-benzhydrylidene-5-phenylcyclopent-3-en-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 24745411) has the molecular formula C34H38N2O4 and a molecular weight of 538.69 g/mol. Its IUPAC name is tert-butyl N-[(1R,5R)-2-benzhydrylidene-5-phenylcyclopent-3-en-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-[(1R,5R)-2-benzhydrylidene-5-phenylcyclopent-3-en-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 24745411 |
| Molecular Formula | C34H38N2O4 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | tert-butyl N-[(1R,5R)-2-benzhydrylidene-5-phenylcyclopent-3-en-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)[C@H]1C(=C(c2ccccc2)c2ccccc2)C=C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C34H38N2O4/c1-33(2,3)39-31(37)35-36(32(38)40-34(4,5)6)30-27(24-16-10-7-11-17-24)22-23-28(30)29(25-18-12-8-13-19-25)26-20-14-9-15-21-26/h7-23,27,30H,1-6H3,(H,35,37)/t27-,30-/m1/s1 |
| InChIKey | CWBBSSWUFSNPFH-POURPWNDSA-N |
| XLogP | 7.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|