C23H32N2O5 — CID 101454176
tert-butyl N-[(1S,2S)-2-(2-methylbenzoyl)cyclopent-3-en-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 101454176) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-2-(2-methylbenzoyl)cyclopent-3-en-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-[(1S,2S)-2-(2-methylbenzoyl)cyclopent-3-en-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 101454176 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | tert-butyl N-[(1S,2S)-2-(2-methylbenzoyl)cyclopent-3-en-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | Cc1ccccc1C(=O)[C@H]1C=CC[C@@H]1N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H32N2O5/c1-15-11-8-9-12-16(15)19(26)17-13-10-14-18(17)25(21(28)30-23(5,6)7)24-20(27)29-22(2,3)4/h8-13,17-18H,14H2,1-7H3,(H,24,27)/t17-,18-/m0/s1 |
| InChIKey | LIDWHNBEJSPVTI-ROUUACIJSA-N |
| XLogP | 4.80 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|