C16H24N2O5 — CID 176836274
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)carbamate (PubChem CID 176836274) has the molecular formula C16H24N2O5 and a molecular weight of 328.40 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 176836274 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)carbamate |
| SMILES | [2H]c1c([2H])c(N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c([2H])c([2H])c1O |
| InChI | InChI=1S/C16H24N2O5/c1-15(2,3)22-13(20)17-18(14(21)23-16(4,5)6)11-7-9-12(19)10-8-11/h7-10,19H,1-6H3,(H,17,20)/i7D,8D,9D,10D |
| InChIKey | LCMPZRWOYMOVEF-ULDPCNCHSA-N |
| XLogP | 3.57 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|