C17H22F2N2O5 — CID 87688867
tert-butyl N-(2,3-difluoro-4-formylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 87688867) has the molecular formula C17H22F2N2O5 and a molecular weight of 372.37 g/mol. Its IUPAC name is tert-butyl N-(2,3-difluoro-4-formylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-(2,3-difluoro-4-formylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 87688867 |
| Molecular Formula | C17H22F2N2O5 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | tert-butyl N-(2,3-difluoro-4-formylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)c1ccc(C=O)c(F)c1F |
| InChI | InChI=1S/C17H22F2N2O5/c1-16(2,3)25-14(23)20-21(15(24)26-17(4,5)6)11-8-7-10(9-22)12(18)13(11)19/h7-9H,1-6H3,(H,20,23) |
| InChIKey | SVBPJAZLTHELLQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|