C15H15F2NO3 — CID 176956925
tert-butyl N-[3-(2,3-difluoro-6-formylphenyl)prop-2-ynyl]carbamate (PubChem CID 176956925) has the molecular formula C15H15F2NO3 and a molecular weight of 295.28 g/mol. Its IUPAC name is tert-butyl N-[3-(2,3-difluoro-6-formylphenyl)prop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,3-difluoro-6-formylphenyl)prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 176956925 |
| Molecular Formula | C15H15F2NO3 |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | tert-butyl N-[3-(2,3-difluoro-6-formylphenyl)prop-2-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC#Cc1c(C=O)ccc(F)c1F |
| InChI | InChI=1S/C15H15F2NO3/c1-15(2,3)21-14(20)18-8-4-5-11-10(9-19)6-7-12(16)13(11)17/h6-7,9H,8H2,1-3H3,(H,18,20) |
| InChIKey | FAUQHVGIIPKYQH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|