C18H24N4O4 — CID 155304905
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-quinoxalin-6-ylcarbamate (PubChem CID 155304905) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-quinoxalin-6-ylcarbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-quinoxalin-6-ylcarbamate |
|---|---|
| PubChem CID | 155304905 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]-N-quinoxalin-6-ylcarbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C18H24N4O4/c1-17(2,3)25-15(23)21-22(16(24)26-18(4,5)6)12-7-8-13-14(11-12)20-10-9-19-13/h7-11H,1-6H3,(H,21,23) |
| InChIKey | KXKMUEFCQKNTHE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|