C21H35N3O4 — CID 15457951
tert-butyl N-(6-hexyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 15457951) has the molecular formula C21H35N3O4 and a molecular weight of 393.53 g/mol. Its IUPAC name is tert-butyl N-(6-hexyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-(6-hexyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 15457951 |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | tert-butyl N-(6-hexyl-3-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CCCCCCc1ccc(N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C21H35N3O4/c1-8-9-10-11-12-16-13-14-17(15-22-16)24(19(26)28-21(5,6)7)23-18(25)27-20(2,3)4/h13-15H,8-12H2,1-7H3,(H,23,25) |
| InChIKey | YUYODPLGVIPGPR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|