C12H17FN2O2 — CID 133059742
tert-butyl N-[(5-fluoro-2-pyridinyl)methyl]-N-methylcarbamate (PubChem CID 133059742) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is tert-butyl N-[(5-fluoro-2-pyridinyl)methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(5-fluoro-2-pyridinyl)methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 133059742 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | tert-butyl N-[(5-fluoro-2-pyridinyl)methyl]-N-methylcarbamate |
| SMILES | CN(Cc1ccc(F)cn1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H17FN2O2/c1-12(2,3)17-11(16)15(4)8-10-6-5-9(13)7-14-10/h5-7H,8H2,1-4H3 |
| InChIKey | ALKIGTSMAJWHKD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |