C20H24FN7O3S — CID 156509947
tert-butyl N-[4-[(Z)-N'-[amino-[(5-fluoro-2-pyridinyl)methyl]amino]carbamimidoyl]phenyl]sulfinyl-N-(cyanomethyl)carbamate (PubChem CID 156509947) has the molecular formula C20H24FN7O3S and a molecular weight of 461.52 g/mol. Its IUPAC name is tert-butyl N-[4-[(Z)-N'-[amino-[(5-fluoro-2-pyridinyl)methyl]amino]carbamimidoyl]phenyl]sulfinyl-N-(cyanomethyl)carbamate.
| Compound Name | tert-butyl N-[4-[(Z)-N'-[amino-[(5-fluoro-2-pyridinyl)methyl]amino]carbamimidoyl]phenyl]sulfinyl-N-(cyanomethyl)carbamate |
|---|---|
| PubChem CID | 156509947 |
| Molecular Formula | C20H24FN7O3S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | tert-butyl N-[4-[(Z)-N'-[amino-[(5-fluoro-2-pyridinyl)methyl]amino]carbamimidoyl]phenyl]sulfinyl-N-(cyanomethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC#N)S(=O)c1ccc(/C(N)=N/N(N)Cc2ccc(F)cn2)cc1 |
| InChI | InChI=1S/C20H24FN7O3S/c1-20(2,3)31-19(29)27(11-10-22)32(30)17-8-4-14(5-9-17)18(23)26-28(24)13-16-7-6-15(21)12-25-16/h4-9,12H,11,13,24H2,1-3H3,(H2,23,26) |
| InChIKey | DJEYYTPSWSYFGK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 150.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|