C12H17N5O2 — CID 174798281
tert-butyl N-amino-N-[5-(2-cyanoethyl)pyrazin-2-yl]carbamate (PubChem CID 174798281) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is tert-butyl N-amino-N-[5-(2-cyanoethyl)pyrazin-2-yl]carbamate.
| Compound Name | tert-butyl N-amino-N-[5-(2-cyanoethyl)pyrazin-2-yl]carbamate |
|---|---|
| PubChem CID | 174798281 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | tert-butyl N-amino-N-[5-(2-cyanoethyl)pyrazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(N)c1cnc(CCC#N)cn1 |
| InChI | InChI=1S/C12H17N5O2/c1-12(2,3)19-11(18)17(14)10-8-15-9(7-16-10)5-4-6-13/h7-8H,4-5,14H2,1-3H3 |
| InChIKey | DBJBCNMHMSQIMC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|