C15H20N6O2 — CID 174798458
tert-butyl N-amino-N-[3,5-bis(2-cyanoethyl)pyrazin-2-yl]carbamate (PubChem CID 174798458) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is tert-butyl N-amino-N-[3,5-bis(2-cyanoethyl)pyrazin-2-yl]carbamate.
| Compound Name | tert-butyl N-amino-N-[3,5-bis(2-cyanoethyl)pyrazin-2-yl]carbamate |
|---|---|
| PubChem CID | 174798458 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | tert-butyl N-amino-N-[3,5-bis(2-cyanoethyl)pyrazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(N)c1ncc(CCC#N)nc1CCC#N |
| InChI | InChI=1S/C15H20N6O2/c1-15(2,3)23-14(22)21(18)13-12(7-5-9-17)20-11(10-19-13)6-4-8-16/h10H,4-7,18H2,1-3H3 |
| InChIKey | QYBPQAVFOGQMEY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|