C17H22FN5O3S — CID 156509948
N'-[amino-[(4-fluorophenyl)methyl]amino]-4-(2,3-dihydroxypropylsulfinamoyl)benzenecarboximidamide (PubChem CID 156509948) has the molecular formula C17H22FN5O3S and a molecular weight of 395.46 g/mol. Its IUPAC name is N'-[amino-[(4-fluorophenyl)methyl]amino]-4-(2,3-dihydroxypropylsulfinamoyl)benzenecarboximidamide.
| Compound Name | N'-[amino-[(4-fluorophenyl)methyl]amino]-4-(2,3-dihydroxypropylsulfinamoyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 156509948 |
| Molecular Formula | C17H22FN5O3S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N'-[amino-[(4-fluorophenyl)methyl]amino]-4-(2,3-dihydroxypropylsulfinamoyl)benzenecarboximidamide |
| SMILES | N/C(=N\N(N)Cc1ccc(F)cc1)c1ccc(S(=O)NCC(O)CO)cc1 |
| InChI | InChI=1S/C17H22FN5O3S/c18-14-5-1-12(2-6-14)10-23(20)22-17(19)13-3-7-16(8-4-13)27(26)21-9-15(25)11-24/h1-8,15,21,24-25H,9-11,20H2,(H2,19,22) |
| InChIKey | WLTFKCJDUPCXSI-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|