C25H32FN3O5 — CID 91052053
tert-butyl N-tert-butyl-N-[[4-[N'-[(4-fluorophenyl)methoxy]carbamimidoyl]phenyl]methoxycarbonyl]carbamate (PubChem CID 91052053) has the molecular formula C25H32FN3O5 and a molecular weight of 473.55 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[[4-[N'-[(4-fluorophenyl)methoxy]carbamimidoyl]phenyl]methoxycarbonyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[[4-[N'-[(4-fluorophenyl)methoxy]carbamimidoyl]phenyl]methoxycarbonyl]carbamate |
|---|---|
| PubChem CID | 91052053 |
| Molecular Formula | C25H32FN3O5 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[[4-[N'-[(4-fluorophenyl)methoxy]carbamimidoyl]phenyl]methoxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OCc1ccc(C(N)=NOCc2ccc(F)cc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C25H32FN3O5/c1-24(2,3)29(23(31)34-25(4,5)6)22(30)32-15-17-7-11-19(12-8-17)21(27)28-33-16-18-9-13-20(26)14-10-18/h7-14H,15-16H2,1-6H3,(H2,27,28) |
| InChIKey | QIDAAUUZWQPHDK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|