C13H20N2O5S — CID 118905606
[5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-pyridinyl]methyl methanesulfonate (PubChem CID 118905606) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is [5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-pyridinyl]methyl methanesulfonate.
| Compound Name | [5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-pyridinyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 118905606 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-pyridinyl]methyl methanesulfonate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccc(COS(C)(=O)=O)nc1 |
| InChI | InChI=1S/C13H20N2O5S/c1-13(2,3)20-12(16)15(4)11-7-6-10(14-8-11)9-19-21(5,17)18/h6-8H,9H2,1-5H3 |
| InChIKey | DLCZWYRRDXGNBK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|