C20H25N3O6 — CID 10621187
tert-butyl N-(3-amino-1,4-dioxonaphthalen-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 10621187) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is tert-butyl N-(3-amino-1,4-dioxonaphthalen-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-(3-amino-1,4-dioxonaphthalen-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 10621187 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | tert-butyl N-(3-amino-1,4-dioxonaphthalen-2-yl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)OC(C)(C)C)C1=C(N)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H25N3O6/c1-19(2,3)28-17(26)22-23(18(27)29-20(4,5)6)14-13(21)15(24)11-9-7-8-10-12(11)16(14)25/h7-10H,21H2,1-6H3,(H,22,26) |
| InChIKey | VBCXFTWZWGPEQJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|