C27H31BrN2O4 — CID 102034653
tert-butyl N-(3-bromo-5-methyl-2-naphthalen-1-ylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 102034653) has the molecular formula C27H31BrN2O4 and a molecular weight of 527.46 g/mol. Its IUPAC name is tert-butyl N-(3-bromo-5-methyl-2-naphthalen-1-ylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-(3-bromo-5-methyl-2-naphthalen-1-ylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 102034653 |
| Molecular Formula | C27H31BrN2O4 |
| Molecular Weight | 527.46 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | tert-butyl N-(3-bromo-5-methyl-2-naphthalen-1-ylphenyl)-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | Cc1cc(Br)c(-c2cccc3ccccc23)c(N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C27H31BrN2O4/c1-17-15-21(28)23(20-14-10-12-18-11-8-9-13-19(18)20)22(16-17)30(25(32)34-27(5,6)7)29-24(31)33-26(2,3)4/h8-16H,1-7H3,(H,29,31) |
| InChIKey | FZYLQKMPLVNQTG-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.46 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|