C17H17Br2NO2 — CID 101464564
tert-butyl N,N-bis(2-bromophenyl)carbamate (PubChem CID 101464564) has the molecular formula C17H17Br2NO2 and a molecular weight of 427.14 g/mol. Its IUPAC name is tert-butyl N,N-bis(2-bromophenyl)carbamate.
| Compound Name | tert-butyl N,N-bis(2-bromophenyl)carbamate |
|---|---|
| PubChem CID | 101464564 |
| Molecular Formula | C17H17Br2NO2 |
| Molecular Weight | 427.14 g/mol |
| Exact Mass | 424.96 |
| IUPAC Name | tert-butyl N,N-bis(2-bromophenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccccc1Br)c1ccccc1Br |
| InChI | InChI=1S/C17H17Br2NO2/c1-17(2,3)22-16(21)20(14-10-6-4-8-12(14)18)15-11-7-5-9-13(15)19/h4-11H,1-3H3 |
| InChIKey | TZIOTLUBUNOBEV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.14 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |