C17H17Cl2NO2 — CID 139244881
tert-butyl N,N-bis(3-chlorophenyl)carbamate (PubChem CID 139244881) has the molecular formula C17H17Cl2NO2 and a molecular weight of 338.23 g/mol. Its IUPAC name is tert-butyl N,N-bis(3-chlorophenyl)carbamate.
| Compound Name | tert-butyl N,N-bis(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 139244881 |
| Molecular Formula | C17H17Cl2NO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | tert-butyl N,N-bis(3-chlorophenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1cccc(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2NO2/c1-17(2,3)22-16(21)20(14-8-4-6-12(18)10-14)15-9-5-7-13(19)11-15/h4-11H,1-3H3 |
| InChIKey | HVEASHGBCJVRMK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |