C17H22ClN3O3 — CID 59364383
tert-butyl N-[2-[3-chloro-N-(2-isocyanoethyl)anilino]-2-oxoethyl]-N-methylcarbamate (PubChem CID 59364383) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is tert-butyl N-[2-[3-chloro-N-(2-isocyanoethyl)anilino]-2-oxoethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[3-chloro-N-(2-isocyanoethyl)anilino]-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59364383 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | tert-butyl N-[2-[3-chloro-N-(2-isocyanoethyl)anilino]-2-oxoethyl]-N-methylcarbamate |
| SMILES | [C-]#[N+]CCN(C(=O)CN(C)C(=O)OC(C)(C)C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H22ClN3O3/c1-17(2,3)24-16(23)20(5)12-15(22)21(10-9-19-4)14-8-6-7-13(18)11-14/h6-8,11H,9-10,12H2,1-3,5H3 |
| InChIKey | OEIONYOADQKODK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|