C15H20Cl2N2O3 — CID 22254314
3-(3-chloro-N-(2-chloroacetyl)anilino)-N-[(2-methylpropan-2-yl)oxy]propanamide (PubChem CID 22254314) has the molecular formula C15H20Cl2N2O3 and a molecular weight of 347.24 g/mol. Its IUPAC name is 3-(3-chloro-N-(2-chloroacetyl)anilino)-N-[(2-methylpropan-2-yl)oxy]propanamide.
| Compound Name | 3-(3-chloro-N-(2-chloroacetyl)anilino)-N-[(2-methylpropan-2-yl)oxy]propanamide |
|---|---|
| PubChem CID | 22254314 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 3-(3-chloro-N-(2-chloroacetyl)anilino)-N-[(2-methylpropan-2-yl)oxy]propanamide |
| SMILES | CC(C)(C)ONC(=O)CCN(C(=O)CCl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2N2O3/c1-15(2,3)22-18-13(20)7-8-19(14(21)10-16)12-6-4-5-11(17)9-12/h4-6,9H,7-8,10H2,1-3H3,(H,18,20) |
| InChIKey | IKZGUGJTKRXASK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|