C21H18ClF3N4O5S — CID 21300379
[4-[6-[3-chloro-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]pyrazin-2-yl]-3-pyridinyl] trifluoromethanesulfonate (PubChem CID 21300379) has the molecular formula C21H18ClF3N4O5S and a molecular weight of 530.91 g/mol. Its IUPAC name is [4-[6-[3-chloro-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]pyrazin-2-yl]-3-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [4-[6-[3-chloro-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]pyrazin-2-yl]-3-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 21300379 |
| Molecular Formula | C21H18ClF3N4O5S |
| Molecular Weight | 530.91 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | [4-[6-[3-chloro-N-[(2-methylpropan-2-yl)oxycarbonyl]anilino]pyrazin-2-yl]-3-pyridinyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)N(c1cccc(Cl)c1)c1cncc(-c2ccncc2OS(=O)(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C21H18ClF3N4O5S/c1-20(2,3)33-19(30)29(14-6-4-5-13(22)9-14)18-12-27-10-16(28-18)15-7-8-26-11-17(15)34-35(31,32)21(23,24)25/h4-12H,1-3H3 |
| InChIKey | MZYABSPOWXKCHK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 111.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.91 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|