C47H51ClN6O5Si — CID 11228239
tert-butyl N-[6-[2-amino-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl-phenylmethoxycarbonylamino]-3-pyridinyl]pyrazin-2-yl]-N-(3-chlorophenyl)carbamate (PubChem CID 11228239) has the molecular formula C47H51ClN6O5Si and a molecular weight of 843.50 g/mol. Its IUPAC name is tert-butyl N-[6-[2-amino-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl-phenylmethoxycarbonylamino]-3-pyridinyl]pyrazin-2-yl]-N-(3-chlorophenyl)carbamate.
| Compound Name | tert-butyl N-[6-[2-amino-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl-phenylmethoxycarbonylamino]-3-pyridinyl]pyrazin-2-yl]-N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 11228239 |
| Molecular Formula | C47H51ClN6O5Si |
| Molecular Weight | 843.50 g/mol |
| Exact Mass | 842.34 |
| IUPAC Name | tert-butyl N-[6-[2-amino-5-[3-[tert-butyl(diphenyl)silyl]oxypropyl-phenylmethoxycarbonylamino]-3-pyridinyl]pyrazin-2-yl]-N-(3-chlorophenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1cccc(Cl)c1)c1cncc(-c2cc(N(CCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(=O)OCc3ccccc3)cnc2N)n1 |
| InChI | InChI=1S/C47H51ClN6O5Si/c1-46(2,3)59-45(56)54(36-21-16-20-35(48)28-36)42-32-50-31-41(52-42)40-29-37(30-51-43(40)49)53(44(55)57-33-34-18-10-7-11-19-34)26-17-27-58-60(47(4,5)6,38-22-12-8-13-23-38)39-24-14-9-15-25-39/h7-16,18-25,28-32H,17,26-27,33H2,1-6H3,(H2,49,51) |
| InChIKey | DOVMKUGQHPLKGJ-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.50 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|