C22H19ClN2O5 — CID 57291322
5-chloro-2-[2-[phenylmethoxycarbonyl(pyridin-4-yl)amino]ethoxy]benzoic acid (PubChem CID 57291322) has the molecular formula C22H19ClN2O5 and a molecular weight of 426.86 g/mol. Its IUPAC name is 5-chloro-2-[2-[phenylmethoxycarbonyl(pyridin-4-yl)amino]ethoxy]benzoic acid.
| Compound Name | 5-chloro-2-[2-[phenylmethoxycarbonyl(pyridin-4-yl)amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 57291322 |
| Molecular Formula | C22H19ClN2O5 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 5-chloro-2-[2-[phenylmethoxycarbonyl(pyridin-4-yl)amino]ethoxy]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1OCCN(C(=O)OCc1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C22H19ClN2O5/c23-17-6-7-20(19(14-17)21(26)27)29-13-12-25(18-8-10-24-11-9-18)22(28)30-15-16-4-2-1-3-5-16/h1-11,14H,12-13,15H2,(H,26,27) |
| InChIKey | DPCBDSHLBVQZEV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |