C23H21ClN2O5 — CID 54506147
methyl 3-chloro-5-[2-[phenylmethoxycarbonyl(pyridin-4-yl)amino]ethoxy]benzoate (PubChem CID 54506147) has the molecular formula C23H21ClN2O5 and a molecular weight of 440.88 g/mol. Its IUPAC name is methyl 3-chloro-5-[2-[phenylmethoxycarbonyl(pyridin-4-yl)amino]ethoxy]benzoate.
| Compound Name | methyl 3-chloro-5-[2-[phenylmethoxycarbonyl(pyridin-4-yl)amino]ethoxy]benzoate |
|---|---|
| PubChem CID | 54506147 |
| Molecular Formula | C23H21ClN2O5 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | methyl 3-chloro-5-[2-[phenylmethoxycarbonyl(pyridin-4-yl)amino]ethoxy]benzoate |
| SMILES | COC(=O)c1cc(Cl)cc(OCCN(C(=O)OCc2ccccc2)c2ccncc2)c1 |
| InChI | InChI=1S/C23H21ClN2O5/c1-29-22(27)18-13-19(24)15-21(14-18)30-12-11-26(20-7-9-25-10-8-20)23(28)31-16-17-5-3-2-4-6-17/h2-10,13-15H,11-12,16H2,1H3 |
| InChIKey | YFVSLNIMFBVCJT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |