C15H11Cl3O4 — CID 20988301
5-chloro-2-[2-(2,5-dichlorophenoxy)ethoxy]benzoic acid (PubChem CID 20988301) has the molecular formula C15H11Cl3O4 and a molecular weight of 361.61 g/mol. Its IUPAC name is 5-chloro-2-[2-(2,5-dichlorophenoxy)ethoxy]benzoic acid.
| Compound Name | 5-chloro-2-[2-(2,5-dichlorophenoxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 20988301 |
| Molecular Formula | C15H11Cl3O4 |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 5-chloro-2-[2-(2,5-dichlorophenoxy)ethoxy]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1OCCOc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H11Cl3O4/c16-9-2-4-13(11(7-9)15(19)20)21-5-6-22-14-8-10(17)1-3-12(14)18/h1-4,7-8H,5-6H2,(H,19,20) |
| InChIKey | DTOOLMBLBVBGPR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|