C13H17ClO3 — CID 61379705
5-chloro-2-(3,3-dimethylbutoxy)benzoic acid (PubChem CID 61379705) has the molecular formula C13H17ClO3 and a molecular weight of 256.73 g/mol. Its IUPAC name is 5-chloro-2-(3,3-dimethylbutoxy)benzoic acid.
| Compound Name | 5-chloro-2-(3,3-dimethylbutoxy)benzoic acid |
|---|---|
| PubChem CID | 61379705 |
| Molecular Formula | C13H17ClO3 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 5-chloro-2-(3,3-dimethylbutoxy)benzoic acid |
| SMILES | CC(C)(C)CCOc1ccc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C13H17ClO3/c1-13(2,3)6-7-17-11-5-4-9(14)8-10(11)12(15)16/h4-5,8H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | SSUKCFFNDXHWNJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |